C29H32N4O2 — CID 68681681
N-[3-(3-aminopropoxy)propyl]-2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]quinazolin-4-amine (PubChem CID 68681681) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[3-(3-aminopropoxy)propyl]-2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]quinazolin-4-amine.
| Compound Name | N-[3-(3-aminopropoxy)propyl]-2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68681681 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[3-(3-aminopropoxy)propyl]-2-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]quinazolin-4-amine |
| SMILES | NCCCOCCCNc1nc(/C=C/c2ccc(OCc3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C29H32N4O2/c30-18-6-20-34-21-7-19-31-29-26-10-4-5-11-27(26)32-28(33-29)17-14-23-12-15-25(16-13-23)35-22-24-8-2-1-3-9-24/h1-5,8-17H,6-7,18-22,30H2,(H,31,32,33)/b17-14+ |
| InChIKey | OHEIGUSTJUFHIM-SAPNQHFASA-N |
| XLogP | 5.55 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|