C24H17ClF3NO3S — CID 171380663
N-[4-[5-(4-chlorophenyl)penta-2,4-dienoyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 171380663) has the molecular formula C24H17ClF3NO3S and a molecular weight of 491.92 g/mol. Its IUPAC name is N-[4-[5-(4-chlorophenyl)penta-2,4-dienoyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[5-(4-chlorophenyl)penta-2,4-dienoyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171380663 |
| Molecular Formula | C24H17ClF3NO3S |
| Molecular Weight | 491.92 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-[4-[5-(4-chlorophenyl)penta-2,4-dienoyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(C=CC=Cc1ccc(Cl)cc1)c1ccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H17ClF3NO3S/c25-20-11-5-17(6-12-20)3-1-2-4-23(30)18-7-13-21(14-8-18)29-33(31,32)22-15-9-19(10-16-22)24(26,27)28/h1-16,29H |
| InChIKey | XAAAPRQFILKAHH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.92 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|