C19H13F2N3O6S2 — CID 57399860
3-N,5-N-bis[(4-fluorophenyl)sulfonyl]pyridine-3,5-dicarboxamide (PubChem CID 57399860) has the molecular formula C19H13F2N3O6S2 and a molecular weight of 481.46 g/mol. Its IUPAC name is 3-N,5-N-bis[(4-fluorophenyl)sulfonyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[(4-fluorophenyl)sulfonyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 57399860 |
| Molecular Formula | C19H13F2N3O6S2 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 3-N,5-N-bis[(4-fluorophenyl)sulfonyl]pyridine-3,5-dicarboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(F)cc1)c1cncc(C(=O)NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H13F2N3O6S2/c20-14-1-5-16(6-2-14)31(27,28)23-18(25)12-9-13(11-22-10-12)19(26)24-32(29,30)17-7-3-15(21)4-8-17/h1-11H,(H,23,25)(H,24,26) |
| InChIKey | FSNGJQINSSIKCT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |