C17H17FN2O5S2 — CID 110166635
3-(1,1-dioxothiazinan-2-yl)-N-(4-fluorophenyl)sulfonylbenzamide (PubChem CID 110166635) has the molecular formula C17H17FN2O5S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(4-fluorophenyl)sulfonylbenzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(4-fluorophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110166635 |
| Molecular Formula | C17H17FN2O5S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(4-fluorophenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(F)cc1)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H17FN2O5S2/c18-14-6-8-16(9-7-14)27(24,25)19-17(21)13-4-3-5-15(12-13)20-10-1-2-11-26(20,22)23/h3-9,12H,1-2,10-11H2,(H,19,21) |
| InChIKey | WFABFJWTEQIUOY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |