C18H20N2O7S3 — CID 110166859
3-(1,1-dioxothiazinan-2-yl)-N-(4-methylsulfonylphenyl)sulfonylbenzamide (PubChem CID 110166859) has the molecular formula C18H20N2O7S3 and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(4-methylsulfonylphenyl)sulfonylbenzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(4-methylsulfonylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110166859 |
| Molecular Formula | C18H20N2O7S3 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(4-methylsulfonylphenyl)sulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NC(=O)c2cccc(N3CCCCS3(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H20N2O7S3/c1-28(22,23)16-7-9-17(10-8-16)30(26,27)19-18(21)14-5-4-6-15(13-14)20-11-2-3-12-29(20,24)25/h4-10,13H,2-3,11-12H2,1H3,(H,19,21) |
| InChIKey | NUNMXPBBPLJWBP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |