C15H14FNO5S2 — CID 110166612
N-(4-fluorophenyl)sulfonyl-3-(methylsulfonylmethyl)benzamide (PubChem CID 110166612) has the molecular formula C15H14FNO5S2 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)sulfonyl-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(4-fluorophenyl)sulfonyl-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 110166612 |
| Molecular Formula | C15H14FNO5S2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(4-fluorophenyl)sulfonyl-3-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H14FNO5S2/c1-23(19,20)10-11-3-2-4-12(9-11)15(18)17-24(21,22)14-7-5-13(16)6-8-14/h2-9H,10H2,1H3,(H,17,18) |
| InChIKey | IQLWYABFKWXGMH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |