C19H18FN3O3S — CID 110166622
3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-fluorophenyl)sulfonylbenzamide (PubChem CID 110166622) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-fluorophenyl)sulfonylbenzamide.
| Compound Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-fluorophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110166622 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-fluorophenyl)sulfonylbenzamide |
| SMILES | Cc1cc(C)n(Cc2cccc(C(=O)NS(=O)(=O)c3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C19H18FN3O3S/c1-13-10-14(2)23(21-13)12-15-4-3-5-16(11-15)19(24)22-27(25,26)18-8-6-17(20)7-9-18/h3-11H,12H2,1-2H3,(H,22,24) |
| InChIKey | CCFBBNYCARPQLC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |