C15H13BrFNO3S — CID 27667525
N-(4-bromo-2-fluorophenyl)-3-(methylsulfonylmethyl)benzamide (PubChem CID 27667525) has the molecular formula C15H13BrFNO3S and a molecular weight of 386.24 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27667525 |
| Molecular Formula | C15H13BrFNO3S |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-3-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)Nc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C15H13BrFNO3S/c1-22(20,21)9-10-3-2-4-11(7-10)15(19)18-14-6-5-12(16)8-13(14)17/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | GAGINAOBNHHXKG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |