C18H19BrN2O4S — CID 27781579
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 27781579) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 27781579 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H19BrN2O4S/c1-12-8-15(19)6-7-16(12)21-17(22)10-20-18(23)14-5-3-4-13(9-14)11-26(2,24)25/h3-9H,10-11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | BGMYYDYJRNFBNJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |