C21H18ClFN2O5S2 — CID 55679771
N-[5-chloro-2-[(2-fluorophenyl)sulfonylamino]phenyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 55679771) has the molecular formula C21H18ClFN2O5S2 and a molecular weight of 496.97 g/mol. Its IUPAC name is N-[5-chloro-2-[(2-fluorophenyl)sulfonylamino]phenyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[5-chloro-2-[(2-fluorophenyl)sulfonylamino]phenyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 55679771 |
| Molecular Formula | C21H18ClFN2O5S2 |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | N-[5-chloro-2-[(2-fluorophenyl)sulfonylamino]phenyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)Nc2cc(Cl)ccc2NS(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C21H18ClFN2O5S2/c1-31(27,28)13-14-5-4-6-15(11-14)21(26)24-19-12-16(22)9-10-18(19)25-32(29,30)20-8-3-2-7-17(20)23/h2-12,25H,13H2,1H3,(H,24,26) |
| InChIKey | UXRLLQPKZUCPND-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |