C14H11ClFNO3S — CID 51149042
N-(5-chloro-2-fluorophenyl)-3-methylsulfonylbenzamide (PubChem CID 51149042) has the molecular formula C14H11ClFNO3S and a molecular weight of 327.76 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-3-methylsulfonylbenzamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51149042 |
| Molecular Formula | C14H11ClFNO3S |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C14H11ClFNO3S/c1-21(19,20)11-4-2-3-9(7-11)14(18)17-13-8-10(15)5-6-12(13)16/h2-8H,1H3,(H,17,18) |
| InChIKey | UYRMJJONCISBMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |