C13H10ClFN2O3S — CID 62234738
6-chloro-N-(2-fluoro-5-methylsulfonylphenyl)pyridine-2-carboxamide (PubChem CID 62234738) has the molecular formula C13H10ClFN2O3S and a molecular weight of 328.75 g/mol. Its IUPAC name is 6-chloro-N-(2-fluoro-5-methylsulfonylphenyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(2-fluoro-5-methylsulfonylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62234738 |
| Molecular Formula | C13H10ClFN2O3S |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 6-chloro-N-(2-fluoro-5-methylsulfonylphenyl)pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)c2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C13H10ClFN2O3S/c1-21(19,20)8-5-6-9(15)11(7-8)17-13(18)10-3-2-4-12(14)16-10/h2-7H,1H3,(H,17,18) |
| InChIKey | VMLTYCWGSTWLCR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|