C19H21ClN2O4S — CID 55895232
4-chloro-2-[[3-(methylsulfonylmethyl)benzoyl]amino]-N-propylbenzamide (PubChem CID 55895232) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is 4-chloro-2-[[3-(methylsulfonylmethyl)benzoyl]amino]-N-propylbenzamide.
| Compound Name | 4-chloro-2-[[3-(methylsulfonylmethyl)benzoyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 55895232 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-chloro-2-[[3-(methylsulfonylmethyl)benzoyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(Cl)cc1NC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-3-9-21-19(24)16-8-7-15(20)11-17(16)22-18(23)14-6-4-5-13(10-14)12-27(2,25)26/h4-8,10-11H,3,9,12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | VFYVICIYIAOSKP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |