C19H22FNO3S — CID 51959885
N-ethyl-N-[(1R)-1-(4-fluorophenyl)ethyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 51959885) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is N-ethyl-N-[(1R)-1-(4-fluorophenyl)ethyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-ethyl-N-[(1R)-1-(4-fluorophenyl)ethyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 51959885 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-ethyl-N-[(1R)-1-(4-fluorophenyl)ethyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | CCN(C(=O)c1cccc(CS(C)(=O)=O)c1)[C@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO3S/c1-4-21(14(2)16-8-10-18(20)11-9-16)19(22)17-7-5-6-15(12-17)13-25(3,23)24/h5-12,14H,4,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | GCMJKNROVZBDGS-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |