C17H16F2O4S — CID 51124408
1-(2,4-difluorophenyl)ethyl 3-(methylsulfonylmethyl)benzoate (PubChem CID 51124408) has the molecular formula C17H16F2O4S and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)ethyl 3-(methylsulfonylmethyl)benzoate.
| Compound Name | 1-(2,4-difluorophenyl)ethyl 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 51124408 |
| Molecular Formula | C17H16F2O4S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)ethyl 3-(methylsulfonylmethyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(CS(C)(=O)=O)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2O4S/c1-11(15-7-6-14(18)9-16(15)19)23-17(20)13-5-3-4-12(8-13)10-24(2,21)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | MRXIYSFADXYQJS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |