C16H14F2O4S — CID 47065480
1-(2,5-difluorophenyl)ethyl 3-methylsulfonylbenzoate (PubChem CID 47065480) has the molecular formula C16H14F2O4S and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)ethyl 3-methylsulfonylbenzoate.
| Compound Name | 1-(2,5-difluorophenyl)ethyl 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 47065480 |
| Molecular Formula | C16H14F2O4S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)ethyl 3-methylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1cccc(S(C)(=O)=O)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H14F2O4S/c1-10(14-9-12(17)6-7-15(14)18)22-16(19)11-4-3-5-13(8-11)23(2,20)21/h3-10H,1-2H3 |
| InChIKey | XCXYQEHLFSHKJM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |