C15H10F4O3 — CID 97319439
[(1R)-1-(2,5-difluorophenyl)ethyl] 3,5-difluoro-4-hydroxybenzoate (PubChem CID 97319439) has the molecular formula C15H10F4O3 and a molecular weight of 314.23 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluorophenyl)ethyl] 3,5-difluoro-4-hydroxybenzoate.
| Compound Name | [(1R)-1-(2,5-difluorophenyl)ethyl] 3,5-difluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 97319439 |
| Molecular Formula | C15H10F4O3 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [(1R)-1-(2,5-difluorophenyl)ethyl] 3,5-difluoro-4-hydroxybenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)c(O)c(F)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F4O3/c1-7(10-6-9(16)2-3-11(10)17)22-15(21)8-4-12(18)14(20)13(19)5-8/h2-7,20H,1H3/t7-/m1/s1 |
| InChIKey | UFBKEARLFYCLPC-SSDOTTSWSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |