C15H18FN3O3S — CID 99859445
1-[(2S)-butan-2-yl]-N-(4-fluorophenyl)sulfonyl-5-methylpyrazole-4-carboxamide (PubChem CID 99859445) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-N-(4-fluorophenyl)sulfonyl-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-[(2S)-butan-2-yl]-N-(4-fluorophenyl)sulfonyl-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 99859445 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-N-(4-fluorophenyl)sulfonyl-5-methylpyrazole-4-carboxamide |
| SMILES | CC[C@H](C)n1ncc(C(=O)NS(=O)(=O)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C15H18FN3O3S/c1-4-10(2)19-11(3)14(9-17-19)15(20)18-23(21,22)13-7-5-12(16)6-8-13/h5-10H,4H2,1-3H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | KGMOMGHPILVJAW-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |