About N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide
N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 67178162) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
| PubChem CID | 67178162 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)NC(=O)C1C=CCN1 |
| InChI | InChI=1S/C7H10N2O2/c1-5(10)9-7(11)6-3-2-4-8-6/h2-3,6,8H,4H2,1H3,(H,9,10,11) |
| InChIKey | AWGQBLRNSRWVKX-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The IUPAC name of N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide (CID 67178162) is N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide is CC(=O)NC(=O)C1C=CCN1.
What is the InChIKey of N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The InChIKey is AWGQBLRNSRWVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5(10)9-7(11)6-3-2-4-8-6/h2-3,6,8H,4H2,1H3,(H,9,10,11).
What are the key properties of N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-2,5-dihydro-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 67178162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).