About 2-acetamidobut-3-enamide
2-acetamidobut-3-enamide (PubChem CID 21340822) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-acetamidobut-3-enamide.
Molecular Properties
| Compound Name | 2-acetamidobut-3-enamide |
| PubChem CID | 21340822 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-acetamidobut-3-enamide |
| SMILES | C=CC(NC(C)=O)C(N)=O |
| InChI | InChI=1S/C6H10N2O2/c1-3-5(6(7)10)8-4(2)9/h3,5H,1H2,2H3,(H2,7,10)(H,8,9) |
| InChIKey | MEBDEZCPWUFIQG-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidobut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidobut-3-enamide?
The IUPAC name of 2-acetamidobut-3-enamide (CID 21340822) is 2-acetamidobut-3-enamide.
What is the SMILES notation for 2-acetamidobut-3-enamide?
The canonical SMILES for 2-acetamidobut-3-enamide is C=CC(NC(C)=O)C(N)=O.
What is the InChIKey of 2-acetamidobut-3-enamide?
The InChIKey is MEBDEZCPWUFIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-3-5(6(7)10)8-4(2)9/h3,5H,1H2,2H3,(H2,7,10)(H,8,9).
What are the key properties of 2-acetamidobut-3-enamide?
2-acetamidobut-3-enamide has a molecular weight of 142.16 g/mol, XLogP of -0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidobut-3-enamide is sourced from PubChem (CID 21340822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).