C6H11FN2O — CID 173179196
2-(3-fluoroprop-2-enylamino)propanamide (PubChem CID 173179196) has the molecular formula C6H11FN2O and a molecular weight of 146.17 g/mol. Its IUPAC name is 2-(3-fluoroprop-2-enylamino)propanamide.
| Compound Name | 2-(3-fluoroprop-2-enylamino)propanamide |
|---|---|
| PubChem CID | 173179196 |
| Molecular Formula | C6H11FN2O |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-(3-fluoroprop-2-enylamino)propanamide |
| SMILES | CC(NCC=CF)C(N)=O |
| InChI | InChI=1S/C6H11FN2O/c1-5(6(8)10)9-4-2-3-7/h2-3,5,9H,4H2,1H3,(H2,8,10) |
| InChIKey | AULDQLPHVKWZNP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |