C10H12FNO2S — CID 174823829
1-(4-fluorophenyl)sulfonylcyclobutan-1-amine (PubChem CID 174823829) has the molecular formula C10H12FNO2S and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonylcyclobutan-1-amine.
| Compound Name | 1-(4-fluorophenyl)sulfonylcyclobutan-1-amine |
|---|---|
| PubChem CID | 174823829 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonylcyclobutan-1-amine |
| SMILES | NC1(S(=O)(=O)c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C10H12FNO2S/c11-8-2-4-9(5-3-8)15(13,14)10(12)6-1-7-10/h2-5H,1,6-7,12H2 |
| InChIKey | WINPYRAKXUGGCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |