C20H23FO3S — CID 174968414
2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-ol (PubChem CID 174968414) has the molecular formula C20H23FO3S and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 174968414 |
| Molecular Formula | C20H23FO3S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C20H23FO3S/c1-19(2,22)15-5-7-16(8-6-15)20(13-3-4-14-20)25(23,24)18-11-9-17(21)10-12-18/h5-12,22H,3-4,13-14H2,1-2H3 |
| InChIKey | BFPGIZHFYMJDGK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |