C24H22F2O3S — CID 155297823
1-fluoro-2-[[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenoxy]methyl]benzene (PubChem CID 155297823) has the molecular formula C24H22F2O3S and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-fluoro-2-[[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenoxy]methyl]benzene.
| Compound Name | 1-fluoro-2-[[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 155297823 |
| Molecular Formula | C24H22F2O3S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-fluoro-2-[[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenoxy]methyl]benzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(OCc3ccccc3F)cc2)CCCC1 |
| InChI | InChI=1S/C24H22F2O3S/c25-20-9-13-22(14-10-20)30(27,28)24(15-3-4-16-24)19-7-11-21(12-8-19)29-17-18-5-1-2-6-23(18)26/h1-2,5-14H,3-4,15-17H2 |
| InChIKey | GPKZPYALROIFFH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |