C24H30O3S — CID 155297824
1-[1-(benzenesulfonyl)cyclopentyl]-4-(cyclohexylmethoxy)benzene (PubChem CID 155297824) has the molecular formula C24H30O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)cyclopentyl]-4-(cyclohexylmethoxy)benzene.
| Compound Name | 1-[1-(benzenesulfonyl)cyclopentyl]-4-(cyclohexylmethoxy)benzene |
|---|---|
| PubChem CID | 155297824 |
| Molecular Formula | C24H30O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[1-(benzenesulfonyl)cyclopentyl]-4-(cyclohexylmethoxy)benzene |
| SMILES | O=S(=O)(c1ccccc1)C1(c2ccc(OCC3CCCCC3)cc2)CCCC1 |
| InChI | InChI=1S/C24H30O3S/c25-28(26,23-11-5-2-6-12-23)24(17-7-8-18-24)21-13-15-22(16-14-21)27-19-20-9-3-1-4-10-20/h2,5-6,11-16,20H,1,3-4,7-10,17-19H2 |
| InChIKey | IBJMMJGGUGLXEB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |