C20H18F7NO5S2 — CID 118217583
1,1,1,3,3,3-hexafluoro-2-[4-[3-(4-fluorophenyl)sulfonyl-1-methylsulfonylpyrrolidin-3-yl]phenyl]propan-2-ol (PubChem CID 118217583) has the molecular formula C20H18F7NO5S2 and a molecular weight of 549.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[3-(4-fluorophenyl)sulfonyl-1-methylsulfonylpyrrolidin-3-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-(4-fluorophenyl)sulfonyl-1-methylsulfonylpyrrolidin-3-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 118217583 |
| Molecular Formula | C20H18F7NO5S2 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-(4-fluorophenyl)sulfonyl-1-methylsulfonylpyrrolidin-3-yl]phenyl]propan-2-ol |
| SMILES | CS(=O)(=O)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H18F7NO5S2/c1-34(30,31)28-11-10-17(12-28,35(32,33)16-8-6-15(21)7-9-16)13-2-4-14(5-3-13)18(29,19(22,23)24)20(25,26)27/h2-9,29H,10-12H2,1H3 |
| InChIKey | IOLBLEHHVNHTCN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |