C25H24F7NO4S — CID 134374480
3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(oxan-4-yl)phenyl]sulfonylpyrrolidine-1-carbaldehyde (PubChem CID 134374480) has the molecular formula C25H24F7NO4S and a molecular weight of 567.52 g/mol. Its IUPAC name is 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(oxan-4-yl)phenyl]sulfonylpyrrolidine-1-carbaldehyde.
| Compound Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(oxan-4-yl)phenyl]sulfonylpyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 134374480 |
| Molecular Formula | C25H24F7NO4S |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(oxan-4-yl)phenyl]sulfonylpyrrolidine-1-carbaldehyde |
| SMILES | O=CN1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2cccc(C3CCOCC3)c2)C1 |
| InChI | InChI=1S/C25H24F7NO4S/c26-23(24(27,28)29,25(30,31)32)20-6-4-19(5-7-20)22(10-11-33(15-22)16-34)38(35,36)21-3-1-2-18(14-21)17-8-12-37-13-9-17/h1-7,14,16-17H,8-13,15H2 |
| InChIKey | PWJZVTKDIKQEEF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|