C20H15ClF7NOS — CID 134374136
3-(3-chlorophenyl)sulfanyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbaldehyde (PubChem CID 134374136) has the molecular formula C20H15ClF7NOS and a molecular weight of 485.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbaldehyde.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 134374136 |
| Molecular Formula | C20H15ClF7NOS |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbaldehyde |
| SMILES | O=CN1CCC(Sc2cccc(Cl)c2)(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H15ClF7NOS/c21-15-2-1-3-16(10-15)31-17(8-9-29(11-17)12-30)13-4-6-14(7-5-13)18(22,19(23,24)25)20(26,27)28/h1-7,10,12H,8-9,11H2 |
| InChIKey | GJWYJOKHANNADH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|