C23H23F6NO3S — CID 174943754
1-[3-[3-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]pyrrolidin-3-yl]sulfonylphenyl]cyclobutan-1-ol (PubChem CID 174943754) has the molecular formula C23H23F6NO3S and a molecular weight of 507.50 g/mol. Its IUPAC name is 1-[3-[3-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]pyrrolidin-3-yl]sulfonylphenyl]cyclobutan-1-ol.
| Compound Name | 1-[3-[3-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]pyrrolidin-3-yl]sulfonylphenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 174943754 |
| Molecular Formula | C23H23F6NO3S |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 1-[3-[3-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenyl]pyrrolidin-3-yl]sulfonylphenyl]cyclobutan-1-ol |
| SMILES | O=S(=O)(c1cccc(C2(O)CCC2)c1)C1(c2ccc(C(F)(C(F)F)C(F)(F)F)cc2)CCNC1 |
| InChI | InChI=1S/C23H23F6NO3S/c24-19(25)22(26,23(27,28)29)16-7-5-15(6-8-16)21(11-12-30-14-21)34(32,33)18-4-1-3-17(13-18)20(31)9-2-10-20/h1,3-8,13,19,30-31H,2,9-12,14H2 |
| InChIKey | KJXOKSORKVVXCS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |