C27H27FN2O7S — CID 21224284
benzyl 4-[4-(4-fluorophenoxy)phenyl]sulfonyl-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 21224284) has the molecular formula C27H27FN2O7S and a molecular weight of 542.59 g/mol. Its IUPAC name is benzyl 4-[4-(4-fluorophenoxy)phenyl]sulfonyl-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-(4-fluorophenoxy)phenyl]sulfonyl-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21224284 |
| Molecular Formula | C27H27FN2O7S |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | benzyl 4-[4-(4-fluorophenoxy)phenyl]sulfonyl-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | O=C(CC1(S(=O)(=O)c2ccc(Oc3ccc(F)cc3)cc2)CCN(C(=O)OCc2ccccc2)CC1)NO |
| InChI | InChI=1S/C27H27FN2O7S/c28-21-6-8-22(9-7-21)37-23-10-12-24(13-11-23)38(34,35)27(18-25(31)29-33)14-16-30(17-15-27)26(32)36-19-20-4-2-1-3-5-20/h1-13,33H,14-19H2,(H,29,31) |
| InChIKey | YHFMEAITCQTZLB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|