C26H26FN3O5S — CID 54007661
benzyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 54007661) has the molecular formula C26H26FN3O5S and a molecular weight of 511.58 g/mol. Its IUPAC name is benzyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54007661 |
| Molecular Formula | C26H26FN3O5S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | benzyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-4-[2-(hydroxyamino)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | O=C(CC1(NC(=O)c2ccc(-c3ccc(F)cc3)s2)CCN(C(=O)OCc2ccccc2)CC1)NO |
| InChI | InChI=1S/C26H26FN3O5S/c27-20-8-6-19(7-9-20)21-10-11-22(36-21)24(32)28-26(16-23(31)29-34)12-14-30(15-13-26)25(33)35-17-18-4-2-1-3-5-18/h1-11,34H,12-17H2,(H,28,32)(H,29,31) |
| InChIKey | KQAVHIITILJZAT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|