C20H19FN2O2 — CID 118179010
benzyl 4-fluorospiro[indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 118179010) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is benzyl 4-fluorospiro[indole-3,4'-piperidine]-1'-carboxylate.
| Compound Name | benzyl 4-fluorospiro[indole-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118179010 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | benzyl 4-fluorospiro[indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(C=Nc3cccc(F)c32)CC1 |
| InChI | InChI=1S/C20H19FN2O2/c21-16-7-4-8-17-18(16)20(14-22-17)9-11-23(12-10-20)19(24)25-13-15-5-2-1-3-6-15/h1-8,14H,9-13H2 |
| InChIKey | HHEQQWVOYRDZJY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |