C20H24ClFN2O5S — CID 139932087
2-[4-[4-(4-fluoro-3-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide;hydrochloride (PubChem CID 139932087) has the molecular formula C20H24ClFN2O5S and a molecular weight of 458.94 g/mol. Its IUPAC name is 2-[4-[4-(4-fluoro-3-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide;hydrochloride.
| Compound Name | 2-[4-[4-(4-fluoro-3-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 139932087 |
| Molecular Formula | C20H24ClFN2O5S |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-[4-[4-(4-fluoro-3-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide;hydrochloride |
| SMILES | Cc1cc(Oc2ccc(S(=O)(=O)C3(CC(=O)NO)CCNCC3)cc2)ccc1F.Cl |
| InChI | InChI=1S/C20H23FN2O5S.ClH/c1-14-12-16(4-7-18(14)21)28-15-2-5-17(6-3-15)29(26,27)20(13-19(24)23-25)8-10-22-11-9-20;/h2-7,12,22,25H,8-11,13H2,1H3,(H,23,24);1H |
| InChIKey | FDPOKMZMFFGYNE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|