C19H21ClFNO6S — CID 159973027
4-[4-(4-chloro-3-methylphenoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrofluoride (PubChem CID 159973027) has the molecular formula C19H21ClFNO6S and a molecular weight of 445.90 g/mol. Its IUPAC name is 4-[4-(4-chloro-3-methylphenoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrofluoride.
| Compound Name | 4-[4-(4-chloro-3-methylphenoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrofluoride |
|---|---|
| PubChem CID | 159973027 |
| Molecular Formula | C19H21ClFNO6S |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 4-[4-(4-chloro-3-methylphenoxy)phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrofluoride |
| SMILES | Cc1cc(Oc2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)ccc1Cl.F |
| InChI | InChI=1S/C19H20ClNO6S.FH/c1-13-12-15(4-7-17(13)20)27-14-2-5-16(6-3-14)28(24,25)19(18(22)21-23)8-10-26-11-9-19;/h2-7,12,23H,8-11H2,1H3,(H,21,22);1H |
| InChIKey | OEUKAUKYYZOYLZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|