C18H28N2O5S — CID 139746806
2-[4-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 139746806) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 139746806 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | COc1ccc(S(=O)(=O)C2(CC(=O)NOC(C)(C)C)CCNCC2)cc1 |
| InChI | InChI=1S/C18H28N2O5S/c1-17(2,3)25-20-16(21)13-18(9-11-19-12-10-18)26(22,23)15-7-5-14(24-4)6-8-15/h5-8,19H,9-13H2,1-4H3,(H,20,21) |
| InChIKey | JGYROOXUEZLUIR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|