C22H27NO6S — CID 70081128
4-[2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]piperidine-4-carboxylic acid (PubChem CID 70081128) has the molecular formula C22H27NO6S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70081128 |
| Molecular Formula | C22H27NO6S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)-2-(4-methoxyphenyl)sulfonylethyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(C(CC2(C(=O)O)CCNCC2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H27NO6S/c1-28-17-5-3-16(4-6-17)20(15-22(21(24)25)11-13-23-14-12-22)30(26,27)19-9-7-18(29-2)8-10-19/h3-10,20,23H,11-15H2,1-2H3,(H,24,25) |
| InChIKey | LKFUJDCNRDAMAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |