C27H36N2O7S — CID 21224255
ethyl 2-[4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]-4-(4-phenoxyphenyl)sulfonylpiperidin-1-yl]acetate (PubChem CID 21224255) has the molecular formula C27H36N2O7S and a molecular weight of 532.66 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]-4-(4-phenoxyphenyl)sulfonylpiperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]-4-(4-phenoxyphenyl)sulfonylpiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 21224255 |
| Molecular Formula | C27H36N2O7S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | ethyl 2-[4-[2-[(2-methylpropan-2-yl)oxyamino]-2-oxoethyl]-4-(4-phenoxyphenyl)sulfonylpiperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(CC(=O)NOC(C)(C)C)(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H36N2O7S/c1-5-34-25(31)20-29-17-15-27(16-18-29,19-24(30)28-36-26(2,3)4)37(32,33)23-13-11-22(12-14-23)35-21-9-7-6-8-10-21/h6-14H,5,15-20H2,1-4H3,(H,28,30) |
| InChIKey | PFQQOYAWRNEDDY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|