C41H61NO8 — CID 175788553
4-[(1,3-dimethylpyrrolidine-3-carbonyl)oxymethyl]-2,6-bis(6-phenylmethoxyhexyl)heptanedioic acid (PubChem CID 175788553) has the molecular formula C41H61NO8 and a molecular weight of 695.94 g/mol. Its IUPAC name is 4-[(1,3-dimethylpyrrolidine-3-carbonyl)oxymethyl]-2,6-bis(6-phenylmethoxyhexyl)heptanedioic acid.
| Compound Name | 4-[(1,3-dimethylpyrrolidine-3-carbonyl)oxymethyl]-2,6-bis(6-phenylmethoxyhexyl)heptanedioic acid |
|---|---|
| PubChem CID | 175788553 |
| Molecular Formula | C41H61NO8 |
| Molecular Weight | 695.94 g/mol |
| Exact Mass | 695.44 |
| IUPAC Name | 4-[(1,3-dimethylpyrrolidine-3-carbonyl)oxymethyl]-2,6-bis(6-phenylmethoxyhexyl)heptanedioic acid |
| SMILES | CN1CCC(C)(C(=O)OCC(CC(CCCCCCOCc2ccccc2)C(=O)O)CC(CCCCCCOCc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C41H61NO8/c1-41(23-24-42(2)32-41)40(47)50-31-35(27-36(38(43)44)21-13-3-5-15-25-48-29-33-17-9-7-10-18-33)28-37(39(45)46)22-14-4-6-16-26-49-30-34-19-11-8-12-20-34/h7-12,17-20,35-37H,3-6,13-16,21-32H2,1-2H3,(H,43,44)(H,45,46) |
| InChIKey | LHIVQCISKPJFQF-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.94 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|