C21H23Cl2F3NO5P — CID 66593848
4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)butan-2-amine (PubChem CID 66593848) has the molecular formula C21H23Cl2F3NO5P and a molecular weight of 528.29 g/mol. Its IUPAC name is 4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)butan-2-amine.
| Compound Name | 4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 66593848 |
| Molecular Formula | C21H23Cl2F3NO5P |
| Molecular Weight | 528.29 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphetan-4-yl)butan-2-amine |
| SMILES | CC(N)(CCc1ccc(OCCCc2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1)C1OP(=O)(O)O1 |
| InChI | InChI=1S/C21H23Cl2F3NO5P/c1-20(27,19-31-33(28,29)32-19)9-8-14-5-7-18(15(11-14)21(24,25)26)30-10-2-3-13-4-6-16(22)17(23)12-13/h4-7,11-12,19H,2-3,8-10,27H2,1H3,(H,28,29) |
| InChIKey | AICBAGYAJYUMLV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.29 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|