C29H37Cl3F3N4O2+ — CID 145378511
[1-amino-3-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-ethyl-2-methylheptylidene]azanium;chloromethane (PubChem CID 145378511) has the molecular formula C29H37Cl3F3N4O2+ and a molecular weight of 636.99 g/mol. Its IUPAC name is [1-amino-3-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-ethyl-2-methylheptylidene]azanium;chloromethane.
| Compound Name | [1-amino-3-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-ethyl-2-methylheptylidene]azanium;chloromethane |
|---|---|
| PubChem CID | 145378511 |
| Molecular Formula | C29H37Cl3F3N4O2+ |
| Molecular Weight | 636.99 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | [1-amino-3-[3-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-2-ethyl-2-methylheptylidene]azanium;chloromethane |
| SMILES | CCCCC(c1nc(-c2ccc(OCCCc3ccc(Cl)c(Cl)c3)c(C(F)(F)F)c2)no1)C(C)(CC)C(N)=[NH2+].CCl |
| InChI | InChI=1S/C28H33Cl2F3N4O2.CH3Cl/c1-4-6-9-19(27(3,5-2)26(34)35)25-36-24(37-39-25)18-11-13-23(20(16-18)28(31,32)33)38-14-7-8-17-10-12-21(29)22(30)15-17;1-2/h10-13,15-16,19H,4-9,14H2,1-3H3,(H3,34,35);1H3/p+1 |
| InChIKey | IAXBQQRMRZTLEL-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.99 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|