C24H35F3N4O2 — CID 145056731
ethanimidamide;3-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]-5-[(2S)-hexan-2-yl]-1,2,4-oxadiazole (PubChem CID 145056731) has the molecular formula C24H35F3N4O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is ethanimidamide;3-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]-5-[(2S)-hexan-2-yl]-1,2,4-oxadiazole.
| Compound Name | ethanimidamide;3-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]-5-[(2S)-hexan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145056731 |
| Molecular Formula | C24H35F3N4O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | ethanimidamide;3-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]-5-[(2S)-hexan-2-yl]-1,2,4-oxadiazole |
| SMILES | CCCC/C=C/COc1ccc(-c2noc([C@@H](C)CCCC)n2)cc1C(F)(F)F.[H]/N=C(\C)N |
| InChI | InChI=1S/C22H29F3N2O2.C2H6N2/c1-4-6-8-9-10-14-28-19-13-12-17(15-18(19)22(23,24)25)20-26-21(29-27-20)16(3)11-7-5-2;1-2(3)4/h9-10,12-13,15-16H,4-8,11,14H2,1-3H3;1H3,(H3,3,4)/b10-9+;/t16-;/m0./s1 |
| InChIKey | KGVVLQATSRFWNT-GNRRYWCFSA-N |
| XLogP | 7.12 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|