C20H25F3N5O2+ — CID 140927087
[(2S)-2-[3-[4-hex-2-enoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine (PubChem CID 140927087) has the molecular formula C20H25F3N5O2+ and a molecular weight of 424.45 g/mol. Its IUPAC name is [(2S)-2-[3-[4-hex-2-enoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine.
| Compound Name | [(2S)-2-[3-[4-hex-2-enoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 140927087 |
| Molecular Formula | C20H25F3N5O2+ |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [(2S)-2-[3-[4-hex-2-enoxy-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
| SMILES | CCCC=CCOc1ccc(-c2noc([C@@H]3CCC[N+]3=C(N)N)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H24F3N5O2/c1-2-3-4-5-11-29-16-9-8-13(12-14(16)20(21,22)23)17-26-18(30-27-17)15-7-6-10-28(15)19(24)25/h4-5,8-9,12,15H,2-3,6-7,10-11H2,1H3,(H3,24,25)/p+1/t15-/m0/s1 |
| InChIKey | IVKVKPLSTYRHLL-HNNXBMFYSA-O |
| XLogP | 3.61 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|