C30H28ClN5O2 — CID 121256929
[(2S)-2-[3-[6-[(4-phenylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride (PubChem CID 121256929) has the molecular formula C30H28ClN5O2 and a molecular weight of 526.04 g/mol. Its IUPAC name is [(2S)-2-[3-[6-[(4-phenylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride.
| Compound Name | [(2S)-2-[3-[6-[(4-phenylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride |
|---|---|
| PubChem CID | 121256929 |
| Molecular Formula | C30H28ClN5O2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [(2S)-2-[3-[6-[(4-phenylphenyl)methoxy]naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride |
| SMILES | NC(N)=[N+]1CCC[C@H]1c1nc(-c2ccc3cc(OCc4ccc(-c5ccccc5)cc4)ccc3c2)no1.[Cl-] |
| InChI | InChI=1S/C30H27N5O2.ClH/c31-30(32)35-16-4-7-27(35)29-33-28(34-37-29)25-13-12-24-18-26(15-14-23(24)17-25)36-19-20-8-10-22(11-9-20)21-5-2-1-3-6-21;/h1-3,5-6,8-15,17-18,27H,4,7,16,19H2,(H3,31,32);1H/t27-;/m0./s1 |
| InChIKey | JDXMGPOAALIDOT-YCBFMBTMSA-N |
| XLogP | 2.26 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|