C22H26ClN5O3 — CID 158892656
(2S,3S)-1-(diaminomethylidene)-2-[3-[3-methyl-4-[(4-methylphenyl)methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride (PubChem CID 158892656) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is (2S,3S)-1-(diaminomethylidene)-2-[3-[3-methyl-4-[(4-methylphenyl)methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride.
| Compound Name | (2S,3S)-1-(diaminomethylidene)-2-[3-[3-methyl-4-[(4-methylphenyl)methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
|---|---|
| PubChem CID | 158892656 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (2S,3S)-1-(diaminomethylidene)-2-[3-[3-methyl-4-[(4-methylphenyl)methoxy]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-3-ol chloride |
| SMILES | Cc1ccc(COc2ccc(-c3noc([C@@H]4[C@@H](O)CC[N+]4=C(N)N)n3)cc2C)cc1.[Cl-] |
| InChI | InChI=1S/C22H25N5O3.ClH/c1-13-3-5-15(6-4-13)12-29-18-8-7-16(11-14(18)2)20-25-21(30-26-20)19-17(28)9-10-27(19)22(23)24;/h3-8,11,17,19,28H,9-10,12H2,1-2H3,(H3,23,24);1H/t17-,19-;/m0./s1 |
| InChIKey | QEGDGBXPXBNNBK-QQTWVUFVSA-N |
| XLogP | -0.97 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|