C22H28ClN5O3 — CID 121256814
[(2S)-2-[3-[6-(4-methoxybutoxy)naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride (PubChem CID 121256814) has the molecular formula C22H28ClN5O3 and a molecular weight of 445.95 g/mol. Its IUPAC name is [(2S)-2-[3-[6-(4-methoxybutoxy)naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride.
| Compound Name | [(2S)-2-[3-[6-(4-methoxybutoxy)naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride |
|---|---|
| PubChem CID | 121256814 |
| Molecular Formula | C22H28ClN5O3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(2S)-2-[3-[6-(4-methoxybutoxy)naphthalen-2-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine chloride |
| SMILES | COCCCCOc1ccc2cc(-c3noc([C@@H]4CCC[N+]4=C(N)N)n3)ccc2c1.[Cl-] |
| InChI | InChI=1S/C22H27N5O3.ClH/c1-28-11-2-3-12-29-18-9-8-15-13-17(7-6-16(15)14-18)20-25-21(30-26-20)19-5-4-10-27(19)22(23)24;/h6-9,13-14,19H,2-5,10-12H2,1H3,(H3,23,24);1H/t19-;/m0./s1 |
| InChIKey | WTVYCEQQLSZCLS-FYZYNONXSA-N |
| XLogP | -0.18 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|