C22H26N2O3 — CID 159219508
trans-(1S,2S)-2-[3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-ol (PubChem CID 159219508) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is trans-(1S,2S)-2-[3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 159219508 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | trans-(1S,2S)-2-[3-(6-pentoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-ol |
| SMILES | CCCCCOc1ccc2cc(-c3noc([C@H]4CCC[C@@H]4O)n3)ccc2c1 |
| InChI | InChI=1S/C22H26N2O3/c1-2-3-4-12-26-18-11-10-15-13-17(9-8-16(15)14-18)21-23-22(27-24-21)19-6-5-7-20(19)25/h8-11,13-14,19-20,25H,2-7,12H2,1H3/t19-,20-/m0/s1 |
| InChIKey | KRMUHMVVDDHMTG-PMACEKPBSA-N |
| XLogP | 5.09 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|