C21H25N3O2 — CID 145056901
3-(6-butoxynaphthalen-2-yl)-5-(1-methylpyrrolidin-2-yl)-1,2,4-oxadiazole (PubChem CID 145056901) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-(6-butoxynaphthalen-2-yl)-5-(1-methylpyrrolidin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(6-butoxynaphthalen-2-yl)-5-(1-methylpyrrolidin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145056901 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-(6-butoxynaphthalen-2-yl)-5-(1-methylpyrrolidin-2-yl)-1,2,4-oxadiazole |
| SMILES | CCCCOc1ccc2cc(-c3noc(C4CCCN4C)n3)ccc2c1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-4-12-25-18-10-9-15-13-17(8-7-16(15)14-18)20-22-21(26-23-20)19-6-5-11-24(19)2/h7-10,13-14,19H,3-6,11-12H2,1-2H3 |
| InChIKey | USJJFQSONCBWLA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|