C21H26N5O2+ — CID 131965191
[(2S)-2-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine (PubChem CID 131965191) has the molecular formula C21H26N5O2+ and a molecular weight of 380.47 g/mol. Its IUPAC name is [(2S)-2-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine.
| Compound Name | [(2S)-2-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 131965191 |
| Molecular Formula | C21H26N5O2+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(2S)-2-[3-(6-butoxynaphthalen-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine |
| SMILES | CCCCOc1ccc2cc(-c3noc([C@@H]4CCC[N+]4=C(N)N)n3)ccc2c1 |
| InChI | InChI=1S/C21H25N5O2/c1-2-3-11-27-17-9-8-14-12-16(7-6-15(14)13-17)19-24-20(28-25-19)18-5-4-10-26(18)21(22)23/h6-9,12-13,18H,2-5,10-11H2,1H3,(H3,22,23)/p+1/t18-/m0/s1 |
| InChIKey | GQUZLIHRTAGSGL-SFHVURJKSA-O |
| XLogP | 3.19 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|