C23H27F6N5O4 — CID 121256670
[(2S)-2-[3-[4-[(Z)-hept-3-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine;2,2,2-trifluoroacetate (PubChem CID 121256670) has the molecular formula C23H27F6N5O4 and a molecular weight of 551.49 g/mol. Its IUPAC name is [(2S)-2-[3-[4-[(Z)-hept-3-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine;2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-[3-[4-[(Z)-hept-3-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 121256670 |
| Molecular Formula | C23H27F6N5O4 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | [(2S)-2-[3-[4-[(Z)-hept-3-enoxy]-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-ium-1-ylidene]methanediamine;2,2,2-trifluoroacetate |
| SMILES | CCC/C=C\CCOc1ccc(-c2noc([C@@H]3CCC[N+]3=C(N)N)n2)cc1C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C21H26F3N5O2.C2HF3O2/c1-2-3-4-5-6-12-30-17-10-9-14(13-15(17)21(22,23)24)18-27-19(31-28-18)16-8-7-11-29(16)20(25)26;3-2(4,5)1(6)7/h4-5,9-10,13,16H,2-3,6-8,11-12H2,1H3,(H3,25,26);(H,6,7)/b5-4-;/t16-;/m0./s1 |
| InChIKey | HXZHZASGCJUELJ-TVBLHPMYSA-N |
| XLogP | 3.30 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|