C22H31ClF3N3O2 — CID 154660648
3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole;hydrochloride (PubChem CID 154660648) has the molecular formula C22H31ClF3N3O2 and a molecular weight of 461.96 g/mol. Its IUPAC name is 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 154660648 |
| Molecular Formula | C22H31ClF3N3O2 |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole;hydrochloride |
| SMILES | CCCCCCCCOc1ccc(-c2noc([C@@H]3CCCNC3)n2)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C22H30F3N3O2.ClH/c1-2-3-4-5-6-7-13-29-19-11-10-16(14-18(19)22(23,24)25)20-27-21(30-28-20)17-9-8-12-26-15-17;/h10-11,14,17,26H,2-9,12-13,15H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | SIVJGZWDFDIDKQ-UNTBIKODSA-N |
| XLogP | 6.38 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|